ChemNet > CAS > 342405-34-9 [4-(4-methylpiperazino)phenyl]methanol
342405-34-9 [4-(4-methylpiperazino)phenyl]methanol
| Название продукта |
[4-(4-methylpiperazino)phenyl]methanol |
| Английское название |
[4-(4-methylpiperazino)phenyl]methanol;[4-(4-methylpiperazin-1-yl)phenyl]methanol; 4-[4-(hydroxymethyl)phenyl]-1-methylpiperazin-1-ium |
| Молекулярная формула |
C12H19N2O |
| Молекулярный вес |
207.2915 |
| InChI |
InChI=1/C12H18N2O/c1-13-6-8-14(9-7-13)12-4-2-11(10-15)3-5-12/h2-5,15H,6-10H2,1H3/p+1 |
| Регистрационный номер CAS |
342405-34-9 |
| Молекулярная структура |
![342405-34-9 [4-(4-methylpiperazino)phenyl]methanol](https://images-a.chemnet.com/suppliers/chembase/201/20140.gif)
|
| Температура плавления |
118℃ |
| Точка кипения |
363.7°C at 760 mmHg |
| Температура вспышки |
189.4°C |
| Давление пара |
6.29E-06mmHg at 25°C |
| Символы опасности |
 C:Corrosive;
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
